C24H29N9O — CID 44543081
3-[[(cyanoamino)-[(2S)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methylidene]amino]-N-propan-2-ylbenzamide (PubChem CID 44543081) has the molecular formula C24H29N9O and a molecular weight of 459.56 g/mol. Its IUPAC name is 3-[[(cyanoamino)-[(2S)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methylidene]amino]-N-propan-2-ylbenzamide.
| Compound Name | 3-[[(cyanoamino)-[(2S)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methylidene]amino]-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 44543081 |
| Molecular Formula | C24H29N9O |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.25 |
| IUPAC Name | 3-[[(cyanoamino)-[(2S)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methylidene]amino]-N-propan-2-ylbenzamide |
| SMILES | Cc1c[nH]c2ncnc(N3CCN(/C(=N/c4cccc(C(=O)NC(C)C)c4)NC#N)[C@@H](C)C3)c12 |
| InChI | InChI=1S/C24H29N9O/c1-15(2)30-23(34)18-6-5-7-19(10-18)31-24(27-13-25)33-9-8-32(12-17(33)4)22-20-16(3)11-26-21(20)28-14-29-22/h5-7,10-11,14-15,17H,8-9,12H2,1-4H3,(H,27,31)(H,30,34)(H,26,28,29)/t17-/m0/s1 |
| InChIKey | SHQFPLWVQBAKMP-KRWDZBQOSA-N |
| XLogP | 2.67 |
| TPSA | 125.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|