C25H32N10O — CID 44543084
3-[[(cyanoamino)-[(2S)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methylidene]amino]-N-[2-(dimethylamino)ethyl]benzamide (PubChem CID 44543084) has the molecular formula C25H32N10O and a molecular weight of 488.60 g/mol. Its IUPAC name is 3-[[(cyanoamino)-[(2S)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methylidene]amino]-N-[2-(dimethylamino)ethyl]benzamide.
| Compound Name | 3-[[(cyanoamino)-[(2S)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methylidene]amino]-N-[2-(dimethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 44543084 |
| Molecular Formula | C25H32N10O |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.28 |
| IUPAC Name | 3-[[(cyanoamino)-[(2S)-2-methyl-4-(5-methyl-7H-pyrrolo[2,3-d]pyrimidin-4-yl)piperazin-1-yl]methylidene]amino]-N-[2-(dimethylamino)ethyl]benzamide |
| SMILES | Cc1c[nH]c2ncnc(N3CCN(/C(=N/c4cccc(C(=O)NCCN(C)C)c4)NC#N)[C@@H](C)C3)c12 |
| InChI | InChI=1S/C25H32N10O/c1-17-13-28-22-21(17)23(31-16-30-22)34-10-11-35(18(2)14-34)25(29-15-26)32-20-7-5-6-19(12-20)24(36)27-8-9-33(3)4/h5-7,12-13,16,18H,8-11,14H2,1-4H3,(H,27,36)(H,29,32)(H,28,30,31)/t18-/m0/s1 |
| InChIKey | LSXPHTSMOQWNKP-SFHVURJKSA-N |
| XLogP | 1.83 |
| TPSA | 128.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|