C20H20F3N3 — CID 44543086
(1R)-1-phenyl-N-[(1R)-1-[1-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethyl]ethanamine (PubChem CID 44543086) has the molecular formula C20H20F3N3 and a molecular weight of 359.40 g/mol. Its IUPAC name is (1R)-1-phenyl-N-[(1R)-1-[1-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethyl]ethanamine.
| Compound Name | (1R)-1-phenyl-N-[(1R)-1-[1-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethyl]ethanamine |
|---|---|
| PubChem CID | 44543086 |
| Molecular Formula | C20H20F3N3 |
| Molecular Weight | 359.40 g/mol |
| Exact Mass | 359.16 |
| IUPAC Name | (1R)-1-phenyl-N-[(1R)-1-[1-[4-(trifluoromethyl)phenyl]pyrazol-3-yl]ethyl]ethanamine |
| SMILES | C[C@@H](N[C@H](C)c1ccn(-c2ccc(C(F)(F)F)cc2)n1)c1ccccc1 |
| InChI | InChI=1S/C20H20F3N3/c1-14(16-6-4-3-5-7-16)24-15(2)19-12-13-26(25-19)18-10-8-17(9-11-18)20(21,22)23/h3-15,24H,1-2H3/t14-,15-/m1/s1 |
| InChIKey | VRVCXHIFTPXAPT-HUUCEWRRSA-N |
| XLogP | 5.30 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.40 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |