C13H16F3NO2 — CID 44543190
[(2R,3S)-3-amino-2-ethyl-4,4,4-trifluorobutyl] benzoate (PubChem CID 44543190) has the molecular formula C13H16F3NO2 and a molecular weight of 275.27 g/mol. Its IUPAC name is [(2R,3S)-3-amino-2-ethyl-4,4,4-trifluorobutyl] benzoate.
| Compound Name | [(2R,3S)-3-amino-2-ethyl-4,4,4-trifluorobutyl] benzoate |
|---|---|
| PubChem CID | 44543190 |
| Molecular Formula | C13H16F3NO2 |
| Molecular Weight | 275.27 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | [(2R,3S)-3-amino-2-ethyl-4,4,4-trifluorobutyl] benzoate |
| SMILES | CC[C@@H](COC(=O)c1ccccc1)[C@H](N)C(F)(F)F |
| InChI | InChI=1S/C13H16F3NO2/c1-2-9(11(17)13(14,15)16)8-19-12(18)10-6-4-3-5-7-10/h3-7,9,11H,2,8,17H2,1H3/t9-,11-/m0/s1 |
| InChIKey | CEXXLGOATUZTQA-ONGXEEELSA-N |
| XLogP | 2.76 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.27 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |