About [(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate
[(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate (PubChem CID 44543191) has the molecular formula C14H16F3NO2
and a molecular weight of 287.28 g/mol. Its IUPAC name is [(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate.
Molecular Properties
| Compound Name | [(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate |
| PubChem CID | 44543191 |
| Molecular Formula | C14H16F3NO2 |
| Molecular Weight | 287.28 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | [(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate |
| SMILES | C=CC[C@@H](COC(=O)c1ccccc1)[C@H](N)C(F)(F)F |
| InChI | InChI=1S/C14H16F3NO2/c1-2-6-11(12(18)14(15,16)17)9-20-13(19)10-7-4-3-5-8-10/h2-5,7-8,11-12H,1,6,9,18H2/t11-,12-/m0/s1 |
| InChIKey | REEBQRSPAQOLNQ-RYUDHWBXSA-N |
| XLogP | 2.93 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate?
The IUPAC name of [(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate (CID 44543191) is [(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate.
What is the SMILES notation for [(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate?
The canonical SMILES for [(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate is C=CC[C@@H](COC(=O)c1ccccc1)[C@H](N)C(F)(F)F.
What is the InChIKey of [(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate?
The InChIKey is REEBQRSPAQOLNQ-RYUDHWBXSA-N. The full InChI is InChI=1S/C14H16F3NO2/c1-2-6-11(12(18)14(15,16)17)9-20-13(19)10-7-4-3-5-8-10/h2-5,7-8,11-12H,1,6,9,18H2/t11-,12-/m0/s1.
What are the key properties of [(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate?
[(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate has a molecular weight of 287.28 g/mol, XLogP of 2.93, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]pent-4-enyl] benzoate is sourced from PubChem (CID 44543191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).