About 2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one
2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one (PubChem CID 44543273) has the molecular formula C15H21Cl2NO
and a molecular weight of 302.25 g/mol. Its IUPAC name is 2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one.
Molecular Properties
| Compound Name | 2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one |
| PubChem CID | 44543273 |
| Molecular Formula | C15H21Cl2NO |
| Molecular Weight | 302.25 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one |
| SMILES | CCCC(NC(C)(C)C)C(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H21Cl2NO/c1-5-6-13(18-15(2,3)4)14(19)10-7-8-11(16)12(17)9-10/h7-9,13,18H,5-6H2,1-4H3 |
| InChIKey | VBQDZZHUUPHQGQ-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.25 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one?
The IUPAC name of 2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one (CID 44543273) is 2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one.
What is the SMILES notation for 2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one?
The canonical SMILES for 2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one is CCCC(NC(C)(C)C)C(=O)c1ccc(Cl)c(Cl)c1.
What is the InChIKey of 2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one?
The InChIKey is VBQDZZHUUPHQGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21Cl2NO/c1-5-6-13(18-15(2,3)4)14(19)10-7-8-11(16)12(17)9-10/h7-9,13,18H,5-6H2,1-4H3.
What are the key properties of 2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one?
2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one has a molecular weight of 302.25 g/mol, XLogP of 4.73, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(tert-butylamino)-1-(3,4-dichlorophenyl)pentan-1-one is sourced from PubChem (CID 44543273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).