About 4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile
4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile (PubChem CID 44543404) has the molecular formula C13H6F3NOS
and a molecular weight of 281.26 g/mol. Its IUPAC name is 4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile.
Molecular Properties
| Compound Name | 4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile |
| PubChem CID | 44543404 |
| Molecular Formula | C13H6F3NOS |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.01 |
| IUPAC Name | 4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(C(=O)C(F)(F)F)s2)cc1 |
| InChI | InChI=1S/C13H6F3NOS/c14-13(15,16)12(18)11-6-5-10(19-11)9-3-1-8(7-17)2-4-9/h1-6H |
| InChIKey | HASJMARYCCFZQU-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile?
The IUPAC name of 4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile (CID 44543404) is 4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile.
What is the SMILES notation for 4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile?
The canonical SMILES for 4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile is N#Cc1ccc(-c2ccc(C(=O)C(F)(F)F)s2)cc1.
What is the InChIKey of 4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile?
The InChIKey is HASJMARYCCFZQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6F3NOS/c14-13(15,16)12(18)11-6-5-10(19-11)9-3-1-8(7-17)2-4-9/h1-6H.
What are the key properties of 4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile?
4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile has a molecular weight of 281.26 g/mol, XLogP of 4.03, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(2,2,2-trifluoroacetyl)thiophen-2-yl]benzonitrile is sourced from PubChem (CID 44543404), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).