About tert-butyl-dimethyl-octa-2,7-diynoxysilane
tert-butyl-dimethyl-octa-2,7-diynoxysilane (PubChem CID 44543485) has the molecular formula C14H24OSi
and a molecular weight of 236.43 g/mol. Its IUPAC name is tert-butyl-dimethyl-octa-2,7-diynoxysilane.
Molecular Properties
| Compound Name | tert-butyl-dimethyl-octa-2,7-diynoxysilane |
| PubChem CID | 44543485 |
| Molecular Formula | C14H24OSi |
| Molecular Weight | 236.43 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | tert-butyl-dimethyl-octa-2,7-diynoxysilane |
| SMILES | C#CCCCC#CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H24OSi/c1-7-8-9-10-11-12-13-15-16(5,6)14(2,3)4/h1H,8-10,13H2,2-6H3 |
| InChIKey | RIVCULSKTVLGJQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl-dimethyl-octa-2,7-diynoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl-dimethyl-octa-2,7-diynoxysilane?
The IUPAC name of tert-butyl-dimethyl-octa-2,7-diynoxysilane (CID 44543485) is tert-butyl-dimethyl-octa-2,7-diynoxysilane.
What is the SMILES notation for tert-butyl-dimethyl-octa-2,7-diynoxysilane?
The canonical SMILES for tert-butyl-dimethyl-octa-2,7-diynoxysilane is C#CCCCC#CCO[Si](C)(C)C(C)(C)C.
What is the InChIKey of tert-butyl-dimethyl-octa-2,7-diynoxysilane?
The InChIKey is RIVCULSKTVLGJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H24OSi/c1-7-8-9-10-11-12-13-15-16(5,6)14(2,3)4/h1H,8-10,13H2,2-6H3.
What are the key properties of tert-butyl-dimethyl-octa-2,7-diynoxysilane?
tert-butyl-dimethyl-octa-2,7-diynoxysilane has a molecular weight of 236.43 g/mol, XLogP of 3.82, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl-dimethyl-octa-2,7-diynoxysilane is sourced from PubChem (CID 44543485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).