C7H14O4Se — CID 44543630
(2S,3S,4R,5S,6S)-2-methyl-6-methylselanyloxane-3,4,5-triol (PubChem CID 44543630) has the molecular formula C7H14O4Se and a molecular weight of 241.15 g/mol. Its IUPAC name is (2S,3S,4R,5S,6S)-2-methyl-6-methylselanyloxane-3,4,5-triol.
| Compound Name | (2S,3S,4R,5S,6S)-2-methyl-6-methylselanyloxane-3,4,5-triol |
|---|---|
| PubChem CID | 44543630 |
| Molecular Formula | C7H14O4Se |
| Molecular Weight | 241.15 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | (2S,3S,4R,5S,6S)-2-methyl-6-methylselanyloxane-3,4,5-triol |
| SMILES | C[Se][C@@H]1O[C@@H](C)[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C7H14O4Se/c1-3-4(8)5(9)6(10)7(11-3)12-2/h3-10H,1-2H3/t3-,4+,5+,6-,7-/m0/s1 |
| InChIKey | VHTNTJQSKJZERS-XUVCUMPTSA-N |
| XLogP | -1.43 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.15 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|