About 4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol
4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol (PubChem CID 44543647) has the molecular formula C14H13Br2NO
and a molecular weight of 371.07 g/mol. Its IUPAC name is 4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol.
Molecular Properties
| Compound Name | 4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol |
| PubChem CID | 44543647 |
| Molecular Formula | C14H13Br2NO |
| Molecular Weight | 371.07 g/mol |
| Exact Mass | 368.94 |
| IUPAC Name | 4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol |
| SMILES | Nc1ccc(CCc2cc(Br)c(O)c(Br)c2)cc1 |
| InChI | InChI=1S/C14H13Br2NO/c15-12-7-10(8-13(16)14(12)18)2-1-9-3-5-11(17)6-4-9/h3-8,18H,1-2,17H2 |
| InChIKey | FEGUWTAFJUALAZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.07 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol?
The IUPAC name of 4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol (CID 44543647) is 4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol.
What is the SMILES notation for 4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol?
The canonical SMILES for 4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol is Nc1ccc(CCc2cc(Br)c(O)c(Br)c2)cc1.
What is the InChIKey of 4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol?
The InChIKey is FEGUWTAFJUALAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13Br2NO/c15-12-7-10(8-13(16)14(12)18)2-1-9-3-5-11(17)6-4-9/h3-8,18H,1-2,17H2.
What are the key properties of 4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol?
4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol has a molecular weight of 371.07 g/mol, XLogP of 4.28, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-(4-aminophenyl)ethyl]-2,6-dibromophenol is sourced from PubChem (CID 44543647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).