C24H35F3N4O3 — CID 44543677
N-[2-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]pyrazol-3-yl]cyclohexanecarboxamide;2,2,2-trifluoroacetic acid (PubChem CID 44543677) has the molecular formula C24H35F3N4O3 and a molecular weight of 484.56 g/mol. Its IUPAC name is N-[2-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]pyrazol-3-yl]cyclohexanecarboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]pyrazol-3-yl]cyclohexanecarboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44543677 |
| Molecular Formula | C24H35F3N4O3 |
| Molecular Weight | 484.56 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | N-[2-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]pyrazol-3-yl]cyclohexanecarboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1ccnn1C1CCN(CC2CC=CCC2)CC1)C1CCCCC1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C22H34N4O.C2HF3O2/c27-22(19-9-5-2-6-10-19)24-21-11-14-23-26(21)20-12-15-25(16-13-20)17-18-7-3-1-4-8-18;3-2(4,5)1(6)7/h1,3,11,14,18-20H,2,4-10,12-13,15-17H2,(H,24,27);(H,6,7) |
| InChIKey | TWAPYUBSBJTVKO-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.56 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|