C22H27F3N4O3S — CID 44543693
N-[2-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]pyrazol-3-yl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid (PubChem CID 44543693) has the molecular formula C22H27F3N4O3S and a molecular weight of 484.54 g/mol. Its IUPAC name is N-[2-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]pyrazol-3-yl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid.
| Compound Name | N-[2-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]pyrazol-3-yl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 44543693 |
| Molecular Formula | C22H27F3N4O3S |
| Molecular Weight | 484.54 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | N-[2-[1-(cyclohex-3-en-1-ylmethyl)piperidin-4-yl]pyrazol-3-yl]thiophene-2-carboxamide;2,2,2-trifluoroacetic acid |
| SMILES | O=C(Nc1ccnn1C1CCN(CC2CC=CCC2)CC1)c1cccs1.O=C(O)C(F)(F)F |
| InChI | InChI=1S/C20H26N4OS.C2HF3O2/c25-20(18-7-4-14-26-18)22-19-8-11-21-24(19)17-9-12-23(13-10-17)15-16-5-2-1-3-6-16;3-2(4,5)1(6)7/h1-2,4,7-8,11,14,16-17H,3,5-6,9-10,12-13,15H2,(H,22,25);(H,6,7) |
| InChIKey | SARHDJRVYIEJMU-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.54 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|