C25H32Br2Cl2N2O3 — CID 44543754
9-(3,4-dichlorophenyl)-2,7-bis[(dimethylamino)methyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione;dihydrobromide (PubChem CID 44543754) has the molecular formula C25H32Br2Cl2N2O3 and a molecular weight of 639.26 g/mol. Its IUPAC name is 9-(3,4-dichlorophenyl)-2,7-bis[(dimethylamino)methyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione;dihydrobromide.
| Compound Name | 9-(3,4-dichlorophenyl)-2,7-bis[(dimethylamino)methyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione;dihydrobromide |
|---|---|
| PubChem CID | 44543754 |
| Molecular Formula | C25H32Br2Cl2N2O3 |
| Molecular Weight | 639.26 g/mol |
| Exact Mass | 636.02 |
| IUPAC Name | 9-(3,4-dichlorophenyl)-2,7-bis[(dimethylamino)methyl]-3,4,5,6,7,9-hexahydro-2H-xanthene-1,8-dione;dihydrobromide |
| SMILES | Br.Br.CN(C)CC1CCC2=C(C1=O)C(c1ccc(Cl)c(Cl)c1)C1=C(CCC(CN(C)C)C1=O)O2 |
| InChI | InChI=1S/C25H30Cl2N2O3.2BrH/c1-28(2)12-15-6-9-19-22(24(15)30)21(14-5-8-17(26)18(27)11-14)23-20(32-19)10-7-16(25(23)31)13-29(3)4;;/h5,8,11,15-16,21H,6-7,9-10,12-13H2,1-4H3;2*1H |
| InChIKey | INKLAKXQHDQKKZ-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.26 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |