About methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate
methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate (PubChem CID 44543870) has the molecular formula C12H15NO2Se
and a molecular weight of 284.22 g/mol. Its IUPAC name is methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate.
Molecular Properties
| Compound Name | methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate |
| PubChem CID | 44543870 |
| Molecular Formula | C12H15NO2Se |
| Molecular Weight | 284.22 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate |
| SMILES | CCCCc1c[se]c2cc(C(=O)OC)[nH]c12 |
| InChI | InChI=1S/C12H15NO2Se/c1-3-4-5-8-7-16-10-6-9(12(14)15-2)13-11(8)10/h6-7,13H,3-5H2,1-2H3 |
| InChIKey | NZSCHURCVLDYGO-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate?
The IUPAC name of methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate (CID 44543870) is methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate.
What is the SMILES notation for methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate?
The canonical SMILES for methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate is CCCCc1c[se]c2cc(C(=O)OC)[nH]c12.
What is the InChIKey of methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate?
The InChIKey is NZSCHURCVLDYGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2Se/c1-3-4-5-8-7-16-10-6-9(12(14)15-2)13-11(8)10/h6-7,13H,3-5H2,1-2H3.
What are the key properties of methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate?
methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate has a molecular weight of 284.22 g/mol, XLogP of 2.35, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-butyl-4H-selenopheno[3,2-b]pyrrole-5-carboxylate is sourced from PubChem (CID 44543870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).