C20H16F3N3O3 — CID 44543890
2-(2-cyanoethyl)-3-oxo-N-[[4-(trifluoromethoxy)phenyl]methyl]-1H-isoindole-1-carboxamide (PubChem CID 44543890) has the molecular formula C20H16F3N3O3 and a molecular weight of 403.36 g/mol. Its IUPAC name is 2-(2-cyanoethyl)-3-oxo-N-[[4-(trifluoromethoxy)phenyl]methyl]-1H-isoindole-1-carboxamide.
| Compound Name | 2-(2-cyanoethyl)-3-oxo-N-[[4-(trifluoromethoxy)phenyl]methyl]-1H-isoindole-1-carboxamide |
|---|---|
| PubChem CID | 44543890 |
| Molecular Formula | C20H16F3N3O3 |
| Molecular Weight | 403.36 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 2-(2-cyanoethyl)-3-oxo-N-[[4-(trifluoromethoxy)phenyl]methyl]-1H-isoindole-1-carboxamide |
| SMILES | N#CCCN1C(=O)c2ccccc2C1C(=O)NCc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H16F3N3O3/c21-20(22,23)29-14-8-6-13(7-9-14)12-25-18(27)17-15-4-1-2-5-16(15)19(28)26(17)11-3-10-24/h1-2,4-9,17H,3,11-12H2,(H,25,27) |
| InChIKey | ODMIZDMPOAVBLL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 82.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.36 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |