C19H13ClF5N3O — CID 44544145
N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2,3,4,5,6-pentafluorobenzamide (PubChem CID 44544145) has the molecular formula C19H13ClF5N3O and a molecular weight of 429.78 g/mol. Its IUPAC name is N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2,3,4,5,6-pentafluorobenzamide.
| Compound Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2,3,4,5,6-pentafluorobenzamide |
|---|---|
| PubChem CID | 44544145 |
| Molecular Formula | C19H13ClF5N3O |
| Molecular Weight | 429.78 g/mol |
| Exact Mass | 429.07 |
| IUPAC Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-2,3,4,5,6-pentafluorobenzamide |
| SMILES | O=C(NCCCNc1ccnc2cc(Cl)ccc12)c1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C19H13ClF5N3O/c20-9-2-3-10-11(4-7-27-12(10)8-9)26-5-1-6-28-19(29)13-14(21)16(23)18(25)17(24)15(13)22/h2-4,7-8H,1,5-6H2,(H,26,27)(H,28,29) |
| InChIKey | OQIOMMZOGWPZDA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.78 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|