C33H32O10 — CID 44544411
7-but-3-enoxy-2-[3-(4-but-3-enoxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-3,5-dihydroxychromen-4-one (PubChem CID 44544411) has the molecular formula C33H32O10 and a molecular weight of 588.61 g/mol. Its IUPAC name is 7-but-3-enoxy-2-[3-(4-but-3-enoxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-3,5-dihydroxychromen-4-one.
| Compound Name | 7-but-3-enoxy-2-[3-(4-but-3-enoxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-3,5-dihydroxychromen-4-one |
|---|---|
| PubChem CID | 44544411 |
| Molecular Formula | C33H32O10 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 7-but-3-enoxy-2-[3-(4-but-3-enoxy-3-methoxyphenyl)-2-(hydroxymethyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-3,5-dihydroxychromen-4-one |
| SMILES | C=CCCOc1cc(O)c2c(=O)c(O)c(-c3ccc4c(c3)OC(c3ccc(OCCC=C)c(OC)c3)C(CO)O4)oc2c1 |
| InChI | InChI=1S/C33H32O10/c1-4-6-12-39-21-16-22(35)29-27(17-21)43-33(31(37)30(29)36)20-9-11-24-26(15-20)42-32(28(18-34)41-24)19-8-10-23(25(14-19)38-3)40-13-7-5-2/h4-5,8-11,14-17,28,32,34-35,37H,1-2,6-7,12-13,18H2,3H3 |
| InChIKey | JGWZSZSEHHNPCR-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 137.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|