C16H24O9 — CID 44544431
[(3S,4R,5R,6S)-2,3,5-triacetyloxy-6-propan-2-yloxan-4-yl] acetate (PubChem CID 44544431) has the molecular formula C16H24O9 and a molecular weight of 360.36 g/mol. Its IUPAC name is [(3S,4R,5R,6S)-2,3,5-triacetyloxy-6-propan-2-yloxan-4-yl] acetate.
| Compound Name | [(3S,4R,5R,6S)-2,3,5-triacetyloxy-6-propan-2-yloxan-4-yl] acetate |
|---|---|
| PubChem CID | 44544431 |
| Molecular Formula | C16H24O9 |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | [(3S,4R,5R,6S)-2,3,5-triacetyloxy-6-propan-2-yloxan-4-yl] acetate |
| SMILES | CC(=O)OC1O[C@@H](C(C)C)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H24O9/c1-7(2)12-13(21-8(3)17)14(22-9(4)18)15(23-10(5)19)16(25-12)24-11(6)20/h7,12-16H,1-6H3/t12-,13+,14+,15-,16?/m0/s1 |
| InChIKey | KYXXZWMKYIBKMQ-JSKHOMAGSA-N |
| XLogP | 0.73 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|