C20H27N3O6S — CID 44544452
N-[(3-cyclopentyloxyphenyl)methyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide (PubChem CID 44544452) has the molecular formula C20H27N3O6S and a molecular weight of 437.52 g/mol. Its IUPAC name is N-[(3-cyclopentyloxyphenyl)methyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide.
| Compound Name | N-[(3-cyclopentyloxyphenyl)methyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide |
|---|---|
| PubChem CID | 44544452 |
| Molecular Formula | C20H27N3O6S |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | N-[(3-cyclopentyloxyphenyl)methyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide |
| SMILES | O=c1ccn(COCCCS(=O)(=O)NCc2cccc(OC3CCCC3)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C20H27N3O6S/c24-19-9-10-23(20(25)22-19)15-28-11-4-12-30(26,27)21-14-16-5-3-8-18(13-16)29-17-6-1-2-7-17/h3,5,8-10,13,17,21H,1-2,4,6-7,11-12,14-15H2,(H,22,24,25) |
| InChIKey | HLMGOVBUAQNPQT-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|