C18H23F2N3O6S — CID 44544652
N-[(1R)-1-[3-(2,2-difluoroethoxy)phenyl]ethyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide (PubChem CID 44544652) has the molecular formula C18H23F2N3O6S and a molecular weight of 447.46 g/mol. Its IUPAC name is N-[(1R)-1-[3-(2,2-difluoroethoxy)phenyl]ethyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide.
| Compound Name | N-[(1R)-1-[3-(2,2-difluoroethoxy)phenyl]ethyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide |
|---|---|
| PubChem CID | 44544652 |
| Molecular Formula | C18H23F2N3O6S |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | N-[(1R)-1-[3-(2,2-difluoroethoxy)phenyl]ethyl]-3-[(2,4-dioxopyrimidin-1-yl)methoxy]propane-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)CCCOCn1ccc(=O)[nH]c1=O)c1cccc(OCC(F)F)c1 |
| InChI | InChI=1S/C18H23F2N3O6S/c1-13(14-4-2-5-15(10-14)29-11-16(19)20)22-30(26,27)9-3-8-28-12-23-7-6-17(24)21-18(23)25/h2,4-7,10,13,16,22H,3,8-9,11-12H2,1H3,(H,21,24,25)/t13-/m1/s1 |
| InChIKey | CWJODOXDFWRIIH-CYBMUJFWSA-N |
| XLogP | 1.23 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|