C19H25N3O6S — CID 44544653
3-[(2,4-dioxopyrimidin-1-yl)methoxy]-N-[(1R)-1-(3-prop-2-enoxyphenyl)ethyl]propane-1-sulfonamide (PubChem CID 44544653) has the molecular formula C19H25N3O6S and a molecular weight of 423.49 g/mol. Its IUPAC name is 3-[(2,4-dioxopyrimidin-1-yl)methoxy]-N-[(1R)-1-(3-prop-2-enoxyphenyl)ethyl]propane-1-sulfonamide.
| Compound Name | 3-[(2,4-dioxopyrimidin-1-yl)methoxy]-N-[(1R)-1-(3-prop-2-enoxyphenyl)ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 44544653 |
| Molecular Formula | C19H25N3O6S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | 3-[(2,4-dioxopyrimidin-1-yl)methoxy]-N-[(1R)-1-(3-prop-2-enoxyphenyl)ethyl]propane-1-sulfonamide |
| SMILES | C=CCOc1cccc([C@@H](C)NS(=O)(=O)CCCOCn2ccc(=O)[nH]c2=O)c1 |
| InChI | InChI=1S/C19H25N3O6S/c1-3-10-28-17-7-4-6-16(13-17)15(2)21-29(25,26)12-5-11-27-14-22-9-8-18(23)20-19(22)24/h3-4,6-9,13,15,21H,1,5,10-12,14H2,2H3,(H,20,23,24)/t15-/m1/s1 |
| InChIKey | CJYCIADEIAPASR-OAHLLOKOSA-N |
| XLogP | 1.15 |
| TPSA | 119.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|