C21H23ClN4O3S — CID 44544672
N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-4-methyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide (PubChem CID 44544672) has the molecular formula C21H23ClN4O3S and a molecular weight of 446.96 g/mol. Its IUPAC name is N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-4-methyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide.
| Compound Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-4-methyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
|---|---|
| PubChem CID | 44544672 |
| Molecular Formula | C21H23ClN4O3S |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.12 |
| IUPAC Name | N-[3-[(7-chloroquinolin-4-yl)amino]propyl]-4-methyl-2,3-dihydro-1,4-benzoxazine-7-sulfonamide |
| SMILES | CN1CCOc2cc(S(=O)(=O)NCCCNc3ccnc4cc(Cl)ccc34)ccc21 |
| InChI | InChI=1S/C21H23ClN4O3S/c1-26-11-12-29-21-14-16(4-6-20(21)26)30(27,28)25-9-2-8-23-18-7-10-24-19-13-15(22)3-5-17(18)19/h3-7,10,13-14,25H,2,8-9,11-12H2,1H3,(H,23,24) |
| InChIKey | IXFFKTJWWMVZON-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|