About N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide
N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide (PubChem CID 44544689) has the molecular formula C16H17N5OS
and a molecular weight of 327.41 g/mol. Its IUPAC name is N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide |
| PubChem CID | 44544689 |
| Molecular Formula | C16H17N5OS |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.12 |
| IUPAC Name | N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide |
| SMILES | Cc1cc(CN(C)C(=O)c2cnc(-c3cccnc3)s2)nn1C |
| InChI | InChI=1S/C16H17N5OS/c1-11-7-13(19-21(11)3)10-20(2)16(22)14-9-18-15(23-14)12-5-4-6-17-8-12/h4-9H,10H2,1-3H3 |
| InChIKey | OEGMEFCCNUOFST-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 63.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide?
The IUPAC name of N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide (CID 44544689) is N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide?
The canonical SMILES for N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide is Cc1cc(CN(C)C(=O)c2cnc(-c3cccnc3)s2)nn1C.
What is the InChIKey of N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide?
The InChIKey is OEGMEFCCNUOFST-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N5OS/c1-11-7-13(19-21(11)3)10-20(2)16(22)14-9-18-15(23-14)12-5-4-6-17-8-12/h4-9H,10H2,1-3H3.
What are the key properties of N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide?
N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide has a molecular weight of 327.41 g/mol, XLogP of 2.52, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1,5-dimethylpyrazol-3-yl)methyl]-N-methyl-2-pyridin-3-yl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 44544689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).