C16H20O9 — CID 44544737
[(2S,3R,4R,5S)-4,5,6-triacetyloxy-2-propa-1,2-dienyloxan-3-yl] acetate (PubChem CID 44544737) has the molecular formula C16H20O9 and a molecular weight of 356.33 g/mol. Its IUPAC name is [(2S,3R,4R,5S)-4,5,6-triacetyloxy-2-propa-1,2-dienyloxan-3-yl] acetate.
| Compound Name | [(2S,3R,4R,5S)-4,5,6-triacetyloxy-2-propa-1,2-dienyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 44544737 |
| Molecular Formula | C16H20O9 |
| Molecular Weight | 356.33 g/mol |
| Exact Mass | 356.11 |
| IUPAC Name | [(2S,3R,4R,5S)-4,5,6-triacetyloxy-2-propa-1,2-dienyloxan-3-yl] acetate |
| SMILES | C=C=C[C@@H]1OC(OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H]1OC(C)=O |
| InChI | InChI=1S/C16H20O9/c1-6-7-12-13(21-8(2)17)14(22-9(3)18)15(23-10(4)19)16(25-12)24-11(5)20/h7,12-16H,1H2,2-5H3/t12-,13+,14+,15-,16?/m0/s1 |
| InChIKey | MZUODBCFJZAGMI-JSKHOMAGSA-N |
| XLogP | 0.41 |
| TPSA | 114.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.33 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|