About 6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole
6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole (PubChem CID 44545184) has the molecular formula C14H8N4O2
and a molecular weight of 264.24 g/mol. Its IUPAC name is 6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole.
Molecular Properties
| Compound Name | 6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole |
| PubChem CID | 44545184 |
| Molecular Formula | C14H8N4O2 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | 6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole |
| SMILES | c1cncc(-c2noc(-c3ccc4ncoc4c3)n2)c1 |
| InChI | InChI=1S/C14H8N4O2/c1-2-10(7-15-5-1)13-17-14(20-18-13)9-3-4-11-12(6-9)19-8-16-11/h1-8H |
| InChIKey | RQVFVGFWHIRERH-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole?
The IUPAC name of 6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole (CID 44545184) is 6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole.
What is the SMILES notation for 6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole?
The canonical SMILES for 6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole is c1cncc(-c2noc(-c3ccc4ncoc4c3)n2)c1.
What is the InChIKey of 6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole?
The InChIKey is RQVFVGFWHIRERH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N4O2/c1-2-10(7-15-5-1)13-17-14(20-18-13)9-3-4-11-12(6-9)19-8-16-11/h1-8H.
What are the key properties of 6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole?
6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole has a molecular weight of 264.24 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(3-pyridin-3-yl-1,2,4-oxadiazol-5-yl)-1,3-benzoxazole is sourced from PubChem (CID 44545184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).