C19H26BrF2NO3S — CID 44545235
[(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-thiophen-2-ylacetate bromide (PubChem CID 44545235) has the molecular formula C19H26BrF2NO3S and a molecular weight of 466.39 g/mol. Its IUPAC name is [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-thiophen-2-ylacetate bromide.
| Compound Name | [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-thiophen-2-ylacetate bromide |
|---|---|
| PubChem CID | 44545235 |
| Molecular Formula | C19H26BrF2NO3S |
| Molecular Weight | 466.39 g/mol |
| Exact Mass | 465.08 |
| IUPAC Name | [(3R)-1-methyl-1-azoniabicyclo[2.2.2]octan-3-yl] 2-(3,3-difluorocyclopentyl)-2-hydroxy-2-thiophen-2-ylacetate bromide |
| SMILES | C[N+]12CCC(CC1)[C@@H](OC(=O)C(O)(c1cccs1)C1CCC(F)(F)C1)C2.[Br-] |
| InChI | InChI=1S/C19H26F2NO3S.BrH/c1-22-8-5-13(6-9-22)15(12-22)25-17(23)19(24,16-3-2-10-26-16)14-4-7-18(20,21)11-14;/h2-3,10,13-15,24H,4-9,11-12H2,1H3;1H/q+1;/p-1/t13?,14?,15-,19?,22?;/m0./s1 |
| InChIKey | VPJRRYWFZWAZJT-AKUSWANASA-M |
| XLogP | 0.16 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|