C23H24ClN3O4 — CID 44545304
5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-1-(4-morpholin-4-ylphenyl)pyrrole-2-carboxamide (PubChem CID 44545304) has the molecular formula C23H24ClN3O4 and a molecular weight of 441.92 g/mol. Its IUPAC name is 5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-1-(4-morpholin-4-ylphenyl)pyrrole-2-carboxamide.
| Compound Name | 5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-1-(4-morpholin-4-ylphenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 44545304 |
| Molecular Formula | C23H24ClN3O4 |
| Molecular Weight | 441.92 g/mol |
| Exact Mass | 441.15 |
| IUPAC Name | 5-(5-chloro-2,4-dihydroxyphenyl)-N-ethyl-1-(4-morpholin-4-ylphenyl)pyrrole-2-carboxamide |
| SMILES | CCNC(=O)c1ccc(-c2cc(Cl)c(O)cc2O)n1-c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H24ClN3O4/c1-2-25-23(30)20-8-7-19(17-13-18(24)22(29)14-21(17)28)27(20)16-5-3-15(4-6-16)26-9-11-31-12-10-26/h3-8,13-14,28-29H,2,9-12H2,1H3,(H,25,30) |
| InChIKey | FGZCRFZHYXLFMB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 86.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.92 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|