C14H6ClF3N2O — CID 44545542
3-(5-chloro-3-pyridinyl)-5-(3,4,5-trifluorophenyl)-1,2-oxazole (PubChem CID 44545542) has the molecular formula C14H6ClF3N2O and a molecular weight of 310.66 g/mol. Its IUPAC name is 3-(5-chloro-3-pyridinyl)-5-(3,4,5-trifluorophenyl)-1,2-oxazole.
| Compound Name | 3-(5-chloro-3-pyridinyl)-5-(3,4,5-trifluorophenyl)-1,2-oxazole |
|---|---|
| PubChem CID | 44545542 |
| Molecular Formula | C14H6ClF3N2O |
| Molecular Weight | 310.66 g/mol |
| Exact Mass | 310.01 |
| IUPAC Name | 3-(5-chloro-3-pyridinyl)-5-(3,4,5-trifluorophenyl)-1,2-oxazole |
| SMILES | Fc1cc(-c2cc(-c3cncc(Cl)c3)no2)cc(F)c1F |
| InChI | InChI=1S/C14H6ClF3N2O/c15-9-1-8(5-19-6-9)12-4-13(21-20-12)7-2-10(16)14(18)11(17)3-7/h1-6H |
| InChIKey | BXBFEUNNDKUUCG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.66 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|