C26H38ClNO5 — CID 44545678
2-morpholin-4-ylethyl (Z)-6-[(1R,2S,3R,5R)-5-chloro-2-[(2,3-dimethylphenoxy)methyl]-3-hydroxycyclopentyl]hex-4-enoate (PubChem CID 44545678) has the molecular formula C26H38ClNO5 and a molecular weight of 480.05 g/mol. Its IUPAC name is 2-morpholin-4-ylethyl (Z)-6-[(1R,2S,3R,5R)-5-chloro-2-[(2,3-dimethylphenoxy)methyl]-3-hydroxycyclopentyl]hex-4-enoate.
| Compound Name | 2-morpholin-4-ylethyl (Z)-6-[(1R,2S,3R,5R)-5-chloro-2-[(2,3-dimethylphenoxy)methyl]-3-hydroxycyclopentyl]hex-4-enoate |
|---|---|
| PubChem CID | 44545678 |
| Molecular Formula | C26H38ClNO5 |
| Molecular Weight | 480.05 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | 2-morpholin-4-ylethyl (Z)-6-[(1R,2S,3R,5R)-5-chloro-2-[(2,3-dimethylphenoxy)methyl]-3-hydroxycyclopentyl]hex-4-enoate |
| SMILES | Cc1cccc(OC[C@@H]2[C@@H](C/C=C\CCC(=O)OCCN3CCOCC3)[C@H](Cl)C[C@H]2O)c1C |
| InChI | InChI=1S/C26H38ClNO5/c1-19-7-6-9-25(20(19)2)33-18-22-21(23(27)17-24(22)29)8-4-3-5-10-26(30)32-16-13-28-11-14-31-15-12-28/h3-4,6-7,9,21-24,29H,5,8,10-18H2,1-2H3/b4-3-/t21-,22-,23-,24-/m1/s1 |
| InChIKey | KFQQRJBGMWEIAH-UVBYWBEDSA-N |
| XLogP | 3.89 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.05 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|