C21H18N6 — CID 44545829
12-(4-piperazin-1-ylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 44545829) has the molecular formula C21H18N6 and a molecular weight of 354.42 g/mol. Its IUPAC name is 12-(4-piperazin-1-ylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-(4-piperazin-1-ylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 44545829 |
| Molecular Formula | C21H18N6 |
| Molecular Weight | 354.42 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 12-(4-piperazin-1-ylphenyl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1ncc(-c3ccc(N4CCNCC4)cc3)cc12 |
| InChI | InChI=1S/C21H18N6/c22-11-16-10-18-19-9-15(12-25-21(19)26-20(18)13-24-16)14-1-3-17(4-2-14)27-7-5-23-6-8-27/h1-4,9-10,12-13,23H,5-8H2,(H,25,26) |
| InChIKey | KVHBDYISMMXPRH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 80.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |