C22H18FN5 — CID 44546037
12-[4-(4-fluoropiperidin-4-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 44546037) has the molecular formula C22H18FN5 and a molecular weight of 371.42 g/mol. Its IUPAC name is 12-[4-(4-fluoropiperidin-4-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-[4-(4-fluoropiperidin-4-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 44546037 |
| Molecular Formula | C22H18FN5 |
| Molecular Weight | 371.42 g/mol |
| Exact Mass | 371.15 |
| IUPAC Name | 12-[4-(4-fluoropiperidin-4-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1ncc(-c3ccc(C4(F)CCNCC4)cc3)cc12 |
| InChI | InChI=1S/C22H18FN5/c23-22(5-7-25-8-6-22)16-3-1-14(2-4-16)15-9-19-18-10-17(11-24)26-13-20(18)28-21(19)27-12-15/h1-4,9-10,12-13,25H,5-8H2,(H,27,28) |
| InChIKey | GXIVWDFYMVBXNP-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.42 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |