C16H13N5 — CID 44546102
12-(1,2,3,6-tetrahydropyridin-4-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 44546102) has the molecular formula C16H13N5 and a molecular weight of 275.32 g/mol. Its IUPAC name is 12-(1,2,3,6-tetrahydropyridin-4-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-(1,2,3,6-tetrahydropyridin-4-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 44546102 |
| Molecular Formula | C16H13N5 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 12-(1,2,3,6-tetrahydropyridin-4-yl)-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1ncc(C3=CCNCC3)cc12 |
| InChI | InChI=1S/C16H13N5/c17-7-12-6-13-14-5-11(10-1-3-18-4-2-10)8-20-16(14)21-15(13)9-19-12/h1,5-6,8-9,18H,2-4H2,(H,20,21) |
| InChIKey | XYGDJAHKYRIHJE-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 77.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |