C20H18N6S — CID 44546169
12-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile (PubChem CID 44546169) has the molecular formula C20H18N6S and a molecular weight of 374.47 g/mol. Its IUPAC name is 12-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile.
| Compound Name | 12-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
|---|---|
| PubChem CID | 44546169 |
| Molecular Formula | C20H18N6S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | 12-[4-(piperidin-1-ylmethyl)-1,3-thiazol-2-yl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaene-4-carbonitrile |
| SMILES | N#Cc1cc2c(cn1)[nH]c1ncc(-c3nc(CN4CCCCC4)cs3)cc12 |
| InChI | InChI=1S/C20H18N6S/c21-8-14-7-16-17-6-13(9-23-19(17)25-18(16)10-22-14)20-24-15(12-27-20)11-26-4-2-1-3-5-26/h6-7,9-10,12H,1-5,11H2,(H,23,25) |
| InChIKey | MBPIPVLDYQCJKR-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 81.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |