About (2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid
(2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid (PubChem CID 44546241) has the molecular formula C10H15N3O3S2
and a molecular weight of 289.38 g/mol. Its IUPAC name is (2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid.
Molecular Properties
| Compound Name | (2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid |
| PubChem CID | 44546241 |
| Molecular Formula | C10H15N3O3S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | (2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid |
| SMILES | CC(C)(C)c1csc(N[C@@H](CSN=O)C(=O)O)n1 |
| InChI | InChI=1S/C10H15N3O3S2/c1-10(2,3)7-5-17-9(12-7)11-6(8(14)15)4-18-13-16/h5-6H,4H2,1-3H3,(H,11,12)(H,14,15)/t6-/m0/s1 |
| InChIKey | PCHFMBUDKREDJE-LURJTMIESA-N |
| XLogP | 2.72 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid?
The IUPAC name of (2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid (CID 44546241) is (2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid.
What is the SMILES notation for (2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid?
The canonical SMILES for (2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid is CC(C)(C)c1csc(N[C@@H](CSN=O)C(=O)O)n1.
What is the InChIKey of (2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid?
The InChIKey is PCHFMBUDKREDJE-LURJTMIESA-N. The full InChI is InChI=1S/C10H15N3O3S2/c1-10(2,3)7-5-17-9(12-7)11-6(8(14)15)4-18-13-16/h5-6H,4H2,1-3H3,(H,11,12)(H,14,15)/t6-/m0/s1.
What are the key properties of (2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid?
(2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid has a molecular weight of 289.38 g/mol, XLogP of 2.72, 6 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[(4-tert-butyl-1,3-thiazol-2-yl)amino]-3-nitrososulfanylpropanoic acid is sourced from PubChem (CID 44546241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).