About 1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone
1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone (PubChem CID 44546286) has the molecular formula C16H12N2O2
and a molecular weight of 264.28 g/mol. Its IUPAC name is 1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone.
Molecular Properties
| Compound Name | 1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone |
| PubChem CID | 44546286 |
| Molecular Formula | C16H12N2O2 |
| Molecular Weight | 264.28 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | 1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone |
| SMILES | CC(=O)c1cccc(-c2cc(-c3cccnc3)no2)c1 |
| InChI | InChI=1S/C16H12N2O2/c1-11(19)12-4-2-5-13(8-12)16-9-15(18-20-16)14-6-3-7-17-10-14/h2-10H,1H3 |
| InChIKey | GXYHMOLSNLTUEP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.28 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone?
The IUPAC name of 1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone (CID 44546286) is 1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone.
What is the SMILES notation for 1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone?
The canonical SMILES for 1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone is CC(=O)c1cccc(-c2cc(-c3cccnc3)no2)c1.
What is the InChIKey of 1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone?
The InChIKey is GXYHMOLSNLTUEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O2/c1-11(19)12-4-2-5-13(8-12)16-9-15(18-20-16)14-6-3-7-17-10-14/h2-10H,1H3.
What are the key properties of 1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone?
1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone has a molecular weight of 264.28 g/mol, XLogP of 3.61, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3-pyridin-3-yl-1,2-oxazol-5-yl)phenyl]ethanone is sourced from PubChem (CID 44546286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).