C21H29ClO6 — CID 44546478
2-hydroxyethyl (Z)-6-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[4-(hydroxymethyl)phenoxy]methyl]cyclopentyl]hex-4-enoate (PubChem CID 44546478) has the molecular formula C21H29ClO6 and a molecular weight of 412.91 g/mol. Its IUPAC name is 2-hydroxyethyl (Z)-6-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[4-(hydroxymethyl)phenoxy]methyl]cyclopentyl]hex-4-enoate.
| Compound Name | 2-hydroxyethyl (Z)-6-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[4-(hydroxymethyl)phenoxy]methyl]cyclopentyl]hex-4-enoate |
|---|---|
| PubChem CID | 44546478 |
| Molecular Formula | C21H29ClO6 |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 2-hydroxyethyl (Z)-6-[(1R,2S,3R,5R)-5-chloro-3-hydroxy-2-[[4-(hydroxymethyl)phenoxy]methyl]cyclopentyl]hex-4-enoate |
| SMILES | O=C(CC/C=C\C[C@@H]1[C@@H](COc2ccc(CO)cc2)[C@H](O)C[C@H]1Cl)OCCO |
| InChI | InChI=1S/C21H29ClO6/c22-19-12-20(25)18(14-28-16-8-6-15(13-24)7-9-16)17(19)4-2-1-3-5-21(26)27-11-10-23/h1-2,6-9,17-20,23-25H,3-5,10-14H2/b2-1-/t17-,18-,19-,20-/m1/s1 |
| InChIKey | OWOBEOUSFMLBKT-TWOBBOKPSA-N |
| XLogP | 2.42 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|