C31H42N6O6S — CID 44546610
[1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2S)-2-aminopropanoate (PubChem CID 44546610) has the molecular formula C31H42N6O6S and a molecular weight of 626.80 g/mol. Its IUPAC name is [1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2S)-2-aminopropanoate.
| Compound Name | [1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2S)-2-aminopropanoate |
|---|---|
| PubChem CID | 44546610 |
| Molecular Formula | C31H42N6O6S |
| Molecular Weight | 626.80 g/mol |
| Exact Mass | 626.29 |
| IUPAC Name | [1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2S)-2-aminopropanoate |
| SMILES | C[C@@H](C(=O)OC1CCN(CC1)C(=O)C2CCC(CC2)NC3=NC=CC(=N3)N4C=CC5=C4C=CC=C5OCCCS(=O)(=O)C)N |
| InChI | InChI=1S/C31H42N6O6S/c1-21(32)30(39)43-24-12-16-36(17-13-24)29(38)22-7-9-23(10-8-22)34-31-33-15-11-28(35-31)37-18-14-25-26(37)5-3-6-27(25)42-19-4-20-44(2,40)41/h3,5-6,11,14-15,18,21-24H,4,7-10,12-13,16-17,19-20,32H2,1-2H3,(H,33,34,35)/t21-,22?,23?/m0/s1 |
| InChIKey | LTDZABGFJBCKME-UVKLAMSESA-N |
| XLogP | 3.00 |
| TPSA | 167.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | 1060 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.80 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|