C33H44N6O6S — CID 44546767
[1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2S)-pyrrolidine-2-carboxylate (PubChem CID 44546767) has the molecular formula C33H44N6O6S and a molecular weight of 652.82 g/mol. Its IUPAC name is [1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2S)-pyrrolidine-2-carboxylate.
| Compound Name | [1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2S)-pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 44546767 |
| Molecular Formula | C33H44N6O6S |
| Molecular Weight | 652.82 g/mol |
| Exact Mass | 652.30 |
| IUPAC Name | [1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2S)-pyrrolidine-2-carboxylate |
| SMILES | CS(=O)(=O)CCCOc1cccc2c1ccn2-c1ccnc(NC2CCC(C(=O)N3CCC(OC(=O)[C@@H]4CCCN4)CC3)CC2)n1 |
| InChI | InChI=1S/C33H44N6O6S/c1-46(42,43)22-4-21-44-29-7-2-6-28-26(29)15-20-39(28)30-12-17-35-33(37-30)36-24-10-8-23(9-11-24)31(40)38-18-13-25(14-19-38)45-32(41)27-5-3-16-34-27/h2,6-7,12,15,17,20,23-25,27,34H,3-5,8-11,13-14,16,18-19,21-22H2,1H3,(H,35,36,37)/t23?,24?,27-/m0/s1 |
| InChIKey | ZWORNRRNRYJNRU-CXTIUDGFSA-N |
| XLogP | 3.49 |
| TPSA | 144.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.82 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|