C21H14FN5O — CID 44546797
12-fluoro-13-(6-methoxy-3-pyridinyl)-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 44546797) has the molecular formula C21H14FN5O and a molecular weight of 371.38 g/mol. Its IUPAC name is 12-fluoro-13-(6-methoxy-3-pyridinyl)-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 12-fluoro-13-(6-methoxy-3-pyridinyl)-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 44546797 |
| Molecular Formula | C21H14FN5O |
| Molecular Weight | 371.38 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 12-fluoro-13-(6-methoxy-3-pyridinyl)-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | COc1ccc(-c2c(F)cnc3[nH]c4cnc(-c5cccnc5)cc4c23)cn1 |
| InChI | InChI=1S/C21H14FN5O/c1-28-18-5-4-13(9-25-18)19-15(22)10-26-21-20(19)14-7-16(24-11-17(14)27-21)12-3-2-6-23-8-12/h2-11H,1H3,(H,26,27) |
| InChIKey | UAROGDJEJMFGPW-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |