C25H26ClN3O5 — CID 44546860
2-[3-[7-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1-methylindol-3-yl]propoxy]acetic acid (PubChem CID 44546860) has the molecular formula C25H26ClN3O5 and a molecular weight of 483.95 g/mol. Its IUPAC name is 2-[3-[7-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1-methylindol-3-yl]propoxy]acetic acid.
| Compound Name | 2-[3-[7-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1-methylindol-3-yl]propoxy]acetic acid |
|---|---|
| PubChem CID | 44546860 |
| Molecular Formula | C25H26ClN3O5 |
| Molecular Weight | 483.95 g/mol |
| Exact Mass | 483.16 |
| IUPAC Name | 2-[3-[7-[5-(3-chloro-4-propan-2-yloxyphenyl)-1,2,4-oxadiazol-3-yl]-1-methylindol-3-yl]propoxy]acetic acid |
| SMILES | CC(C)Oc1ccc(-c2nc(-c3cccc4c(CCCOCC(=O)O)cn(C)c34)no2)cc1Cl |
| InChI | InChI=1S/C25H26ClN3O5/c1-15(2)33-21-10-9-16(12-20(21)26)25-27-24(28-34-25)19-8-4-7-18-17(13-29(3)23(18)19)6-5-11-32-14-22(30)31/h4,7-10,12-13,15H,5-6,11,14H2,1-3H3,(H,30,31) |
| InChIKey | NYUSCXYOKMPNRN-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 99.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.95 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|