C33H46N6O6S — CID 44546920
[1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2S)-2-amino-3-methylbutanoate (PubChem CID 44546920) has the molecular formula C33H46N6O6S and a molecular weight of 654.83 g/mol. Its IUPAC name is [1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2S)-2-amino-3-methylbutanoate.
| Compound Name | [1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2S)-2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 44546920 |
| Molecular Formula | C33H46N6O6S |
| Molecular Weight | 654.83 g/mol |
| Exact Mass | 654.32 |
| IUPAC Name | [1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2S)-2-amino-3-methylbutanoate |
| SMILES | CC(C)[C@H](N)C(=O)OC1CCN(C(=O)C2CCC(Nc3nccc(-n4ccc5c(OCCCS(C)(=O)=O)cccc54)n3)CC2)CC1 |
| InChI | InChI=1S/C33H46N6O6S/c1-22(2)30(34)32(41)45-25-13-17-38(18-14-25)31(40)23-8-10-24(11-9-23)36-33-35-16-12-29(37-33)39-19-15-26-27(39)6-4-7-28(26)44-20-5-21-46(3,42)43/h4,6-7,12,15-16,19,22-25,30H,5,8-11,13-14,17-18,20-21,34H2,1-3H3,(H,35,36,37)/t23?,24?,30-/m0/s1 |
| InChIKey | KAGAQWAISISMMA-YFIBMDDPSA-N |
| XLogP | 3.72 |
| TPSA | 158.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.83 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|