C34H46N6O6S — CID 44546921
[1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2R)-1-methylpyrrolidine-2-carboxylate (PubChem CID 44546921) has the molecular formula C34H46N6O6S and a molecular weight of 666.80 g/mol. Its IUPAC name is [1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2R)-1-methylpyrrolidine-2-carboxylate.
| Compound Name | [1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2R)-1-methylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 44546921 |
| Molecular Formula | C34H46N6O6S |
| Molecular Weight | 666.80 g/mol |
| Exact Mass | 666.32 |
| IUPAC Name | [1-[4-[[4-[4-(3-methylsulfonylpropoxy)indol-1-yl]pyrimidin-2-yl]amino]cyclohexanecarbonyl]piperidin-4-yl] (2R)-1-methylpyrrolidine-2-carboxylate |
| SMILES | CN1CCC[C@@H]1C(=O)OC2CCN(CC2)C(=O)C3CCC(CC3)NC4=NC=CC(=N4)N5C=CC6=C5C=CC=C6OCCCS(=O)(=O)C |
| InChI | InChI=1S/C34H46N6O6S/c1-38-18-4-7-29(38)33(42)46-26-14-19-39(20-15-26)32(41)24-9-11-25(12-10-24)36-34-35-17-13-31(37-34)40-21-16-27-28(40)6-3-8-30(27)45-22-5-23-47(2,43)44/h3,6,8,13,16-17,21,24-26,29H,4-5,7,9-12,14-15,18-20,22-23H2,1-2H3,(H,35,36,37)/t24?,25?,29-/m1/s1 |
| InChIKey | YZMJGBVJSINXRV-KZNPQIALSA-N |
| XLogP | 4.10 |
| TPSA | 144.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 47 |
| Complexity | 1150 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 666.80 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|