C24H29N9O2 — CID 44546926
1-[4-[4-(3-aminopropylamino)-6-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea (PubChem CID 44546926) has the molecular formula C24H29N9O2 and a molecular weight of 475.56 g/mol. Its IUPAC name is 1-[4-[4-(3-aminopropylamino)-6-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea.
| Compound Name | 1-[4-[4-(3-aminopropylamino)-6-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea |
|---|---|
| PubChem CID | 44546926 |
| Molecular Formula | C24H29N9O2 |
| Molecular Weight | 475.56 g/mol |
| Exact Mass | 475.24 |
| IUPAC Name | 1-[4-[4-(3-aminopropylamino)-6-(8-oxa-3-azabicyclo[3.2.1]octan-3-yl)-1,3,5-triazin-2-yl]phenyl]-3-pyridin-3-ylurea |
| SMILES | NCCCNc1nc(-c2ccc(NC(=O)Nc3cccnc3)cc2)nc(N2CC3CCC(C2)O3)n1 |
| InChI | InChI=1S/C24H29N9O2/c25-10-2-12-27-22-30-21(31-23(32-22)33-14-19-8-9-20(15-33)35-19)16-4-6-17(7-5-16)28-24(34)29-18-3-1-11-26-13-18/h1,3-7,11,13,19-20H,2,8-10,12,14-15,25H2,(H2,28,29,34)(H,27,30,31,32) |
| InChIKey | OMIVRUYXTVNOIE-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 143.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.56 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|