C20H13FN4O — CID 44546953
12-fluoro-13-(5-methylfuran-2-yl)-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene (PubChem CID 44546953) has the molecular formula C20H13FN4O and a molecular weight of 344.35 g/mol. Its IUPAC name is 12-fluoro-13-(5-methylfuran-2-yl)-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene.
| Compound Name | 12-fluoro-13-(5-methylfuran-2-yl)-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
|---|---|
| PubChem CID | 44546953 |
| Molecular Formula | C20H13FN4O |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.11 |
| IUPAC Name | 12-fluoro-13-(5-methylfuran-2-yl)-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(13),2,4,6,9,11-hexaene |
| SMILES | Cc1ccc(-c2c(F)cnc3[nH]c4cnc(-c5cccnc5)cc4c23)o1 |
| InChI | InChI=1S/C20H13FN4O/c1-11-4-5-17(26-11)19-14(21)9-24-20-18(19)13-7-15(23-10-16(13)25-20)12-3-2-6-22-8-12/h2-10H,1H3,(H,24,25) |
| InChIKey | VUHPXLILSFTSNX-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 67.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |