About 4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline
4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline (PubChem CID 44546960) has the molecular formula C25H29NO3
and a molecular weight of 391.51 g/mol. Its IUPAC name is 4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline.
Molecular Properties
| Compound Name | 4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline |
| PubChem CID | 44546960 |
| Molecular Formula | C25H29NO3 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.21 |
| IUPAC Name | 4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline |
| SMILES | CNc1ccc(/C=C/c2cc3cc(OCC4CCOC(C)(C)C4)ccc3o2)cc1 |
| InChI | InChI=1S/C25H29NO3/c1-25(2)16-19(12-13-28-25)17-27-22-10-11-24-20(14-22)15-23(29-24)9-6-18-4-7-21(26-3)8-5-18/h4-11,14-15,19,26H,12-13,16-17H2,1-3H3/b9-6+ |
| InChIKey | FYCGFBIATGNKJA-RMKNXTFCSA-N |
| XLogP | 6.23 |
| TPSA | 43.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline?
The IUPAC name of 4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline (CID 44546960) is 4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline.
What is the SMILES notation for 4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline?
The canonical SMILES for 4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline is CNc1ccc(/C=C/c2cc3cc(OCC4CCOC(C)(C)C4)ccc3o2)cc1.
What is the InChIKey of 4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline?
The InChIKey is FYCGFBIATGNKJA-RMKNXTFCSA-N. The full InChI is InChI=1S/C25H29NO3/c1-25(2)16-19(12-13-28-25)17-27-22-10-11-24-20(14-22)15-23(29-24)9-6-18-4-7-21(26-3)8-5-18/h4-11,14-15,19,26H,12-13,16-17H2,1-3H3/b9-6+.
What are the key properties of 4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline?
4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline has a molecular weight of 391.51 g/mol, XLogP of 6.23, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-[5-[(2,2-dimethyloxan-4-yl)methoxy]-1-benzofuran-2-yl]ethenyl]-N-methylaniline is sourced from PubChem (CID 44546960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).