C21H28ClN8O2+ — CID 44547107
2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[2-[[2-(1H-indol-3-yl)acetyl]amino]ethyl]-dimethylazanium (PubChem CID 44547107) has the molecular formula C21H28ClN8O2+ and a molecular weight of 459.96 g/mol. Its IUPAC name is 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[2-[[2-(1H-indol-3-yl)acetyl]amino]ethyl]-dimethylazanium.
| Compound Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[2-[[2-(1H-indol-3-yl)acetyl]amino]ethyl]-dimethylazanium |
|---|---|
| PubChem CID | 44547107 |
| Molecular Formula | C21H28ClN8O2+ |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 459.20 |
| IUPAC Name | 2-[(3,5-diamino-6-chloropyrazine-2-carbonyl)amino]ethyl-[2-[[2-(1H-indol-3-yl)acetyl]amino]ethyl]-dimethylazanium |
| SMILES | C[N+](C)(CCNC(=O)Cc1c[nH]c2ccccc12)CCNC(=O)c1nc(Cl)c(N)nc1N |
| InChI | InChI=1S/C21H27ClN8O2/c1-30(2,10-8-26-21(32)17-19(23)29-20(24)18(22)28-17)9-7-25-16(31)11-13-12-27-15-6-4-3-5-14(13)15/h3-6,12,27H,7-11H2,1-2H3,(H5-,23,24,25,26,29,31,32)/p+1 |
| InChIKey | ULMWXYDOFUGDPR-UHFFFAOYSA-O |
| XLogP | 0.94 |
| TPSA | 151.81 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|