About 3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide
3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide (PubChem CID 44547187) has the molecular formula C24H24N4O
and a molecular weight of 384.48 g/mol. Its IUPAC name is 3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide.
Molecular Properties
| Compound Name | 3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide |
| PubChem CID | 44547187 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide |
| SMILES | CC(C)(C(N)=O)C(c1ccc(Nc2ccc3ccccc3c2)cc1)n1ccnc1 |
| InChI | InChI=1S/C24H24N4O/c1-24(2,23(25)29)22(28-14-13-26-16-28)18-8-10-20(11-9-18)27-21-12-7-17-5-3-4-6-19(17)15-21/h3-16,22,27H,1-2H3,(H2,25,29) |
| InChIKey | DHADYTVQZADBKR-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide?
The IUPAC name of 3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide (CID 44547187) is 3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide.
What is the SMILES notation for 3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide?
The canonical SMILES for 3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide is CC(C)(C(N)=O)C(c1ccc(Nc2ccc3ccccc3c2)cc1)n1ccnc1.
What is the InChIKey of 3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide?
The InChIKey is DHADYTVQZADBKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H24N4O/c1-24(2,23(25)29)22(28-14-13-26-16-28)18-8-10-20(11-9-18)27-21-12-7-17-5-3-4-6-19(17)15-21/h3-16,22,27H,1-2H3,(H2,25,29).
What are the key properties of 3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide?
3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide has a molecular weight of 384.48 g/mol, XLogP of 4.88, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-imidazol-1-yl-2,2-dimethyl-3-[4-(naphthalen-2-ylamino)phenyl]propanamide is sourced from PubChem (CID 44547187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).