C31H40N2O9 — CID 44547540
1-O-[(2S,3S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-[(E)-4-morpholin-4-ylbut-2-enyl]butanedioate (PubChem CID 44547540) has the molecular formula C31H40N2O9 and a molecular weight of 584.67 g/mol. Its IUPAC name is 1-O-[(2S,3S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-[(E)-4-morpholin-4-ylbut-2-enyl]butanedioate.
| Compound Name | 1-O-[(2S,3S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-[(E)-4-morpholin-4-ylbut-2-enyl]butanedioate |
|---|---|
| PubChem CID | 44547540 |
| Molecular Formula | C31H40N2O9 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.27 |
| IUPAC Name | 1-O-[(2S,3S,6R)-4-methoxy-16,18-dioxa-10-azapentacyclo[11.7.0.02,6.06,10.015,19]icosa-1(20),4,13,15(19)-tetraen-3-yl] 4-O-methyl (2R)-2-hydroxy-2-[(E)-4-morpholin-4-ylbut-2-enyl]butanedioate |
| SMILES | COC(=O)C[C@](O)(C/C=C/CN1CCOCC1)C(=O)O[C@@H]1C(OC)=C[C@]23CCCN2CCc2cc4c(cc2[C@H]13)OCO4 |
| InChI | InChI=1S/C31H40N2O9/c1-37-25-18-30-7-5-10-33(30)11-6-21-16-23-24(41-20-40-23)17-22(21)27(30)28(25)42-29(35)31(36,19-26(34)38-2)8-3-4-9-32-12-14-39-15-13-32/h3-4,16-18,27-28,36H,5-15,19-20H2,1-2H3/b4-3+/t27-,28-,30+,31-/m1/s1 |
| InChIKey | DJTMWYIQBUMKJW-RAXIFOKESA-N |
| XLogP | 1.92 |
| TPSA | 116.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|