C17H20FN5 — CID 44547871
4-[(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-N-[(4-fluorophenyl)methyl]pyrimidin-2-amine (PubChem CID 44547871) has the molecular formula C17H20FN5 and a molecular weight of 313.38 g/mol. Its IUPAC name is 4-[(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-N-[(4-fluorophenyl)methyl]pyrimidin-2-amine.
| Compound Name | 4-[(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-N-[(4-fluorophenyl)methyl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 44547871 |
| Molecular Formula | C17H20FN5 |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.17 |
| IUPAC Name | 4-[(3aR,6aR)-2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[2,3-c]pyrrol-5-yl]-N-[(4-fluorophenyl)methyl]pyrimidin-2-amine |
| SMILES | Fc1ccc(CNc2nccc(N3C[C@H]4CCN[C@H]4C3)n2)cc1 |
| InChI | InChI=1S/C17H20FN5/c18-14-3-1-12(2-4-14)9-21-17-20-8-6-16(22-17)23-10-13-5-7-19-15(13)11-23/h1-4,6,8,13,15,19H,5,7,9-11H2,(H,20,21,22)/t13-,15+/m1/s1 |
| InChIKey | YTANLRPBUGMQNT-HIFRSBDPSA-N |
| XLogP | 2.03 |
| TPSA | 53.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |