C26H27F3N6O2 — CID 44547901
1-[3-[7-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 44547901) has the molecular formula C26H27F3N6O2 and a molecular weight of 512.54 g/mol. Its IUPAC name is 1-[3-[7-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-[7-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 44547901 |
| Molecular Formula | C26H27F3N6O2 |
| Molecular Weight | 512.54 g/mol |
| Exact Mass | 512.21 |
| IUPAC Name | 1-[3-[7-[6-[3-(dimethylamino)propoxy]-3-pyridinyl]imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CN(C)CCCOc1ccc(-c2ccn3c(-c4cccc(NC(=O)NCC(F)(F)F)c4)cnc3c2)cn1 |
| InChI | InChI=1S/C26H27F3N6O2/c1-34(2)10-4-12-37-24-8-7-20(15-31-24)18-9-11-35-22(16-30-23(35)14-18)19-5-3-6-21(13-19)33-25(36)32-17-26(27,28)29/h3,5-9,11,13-16H,4,10,12,17H2,1-2H3,(H2,32,33,36) |
| InChIKey | DCPPHIRTTFNMRQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 83.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.54 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|